C17H19N9O — CID 167931859
3-[2-(2,2-dimethyloxan-4-yl)-5-(1H-1,2,4-triazol-5-yl)-1,2,4-triazol-3-yl]-2H-pyrazolo[3,4-b]pyridine (PubChem CID 167931859) has the molecular formula C17H19N9O and a molecular weight of 365.40 g/mol. Its IUPAC name is 3-[2-(2,2-dimethyloxan-4-yl)-5-(1H-1,2,4-triazol-5-yl)-1,2,4-triazol-3-yl]-2H-pyrazolo[3,4-b]pyridine.
| Compound Name | 3-[2-(2,2-dimethyloxan-4-yl)-5-(1H-1,2,4-triazol-5-yl)-1,2,4-triazol-3-yl]-2H-pyrazolo[3,4-b]pyridine |
|---|---|
| PubChem CID | 167931859 |
| Molecular Formula | C17H19N9O |
| Molecular Weight | 365.40 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | 3-[2-(2,2-dimethyloxan-4-yl)-5-(1H-1,2,4-triazol-5-yl)-1,2,4-triazol-3-yl]-2H-pyrazolo[3,4-b]pyridine |
| SMILES | CC1(C)CC(n2nc(-c3ncn[nH]3)nc2-c2[nH]nc3ncccc23)CCO1 |
| InChI | InChI=1S/C17H19N9O/c1-17(2)8-10(5-7-27-17)26-16(21-15(25-26)14-19-9-20-23-14)12-11-4-3-6-18-13(11)24-22-12/h3-4,6,9-10H,5,7-8H2,1-2H3,(H,18,22,24)(H,19,20,23) |
| InChIKey | XLPHMLZTFBNUHY-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 123.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.40 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |