About N-(5-fluoro-2-pyridinyl)-N'-(2-propylquinolin-4-yl)ethane-1,2-diamine
N-(5-fluoro-2-pyridinyl)-N'-(2-propylquinolin-4-yl)ethane-1,2-diamine (PubChem CID 167935119) has the molecular formula C19H21FN4
and a molecular weight of 324.40 g/mol. Its IUPAC name is N-(5-fluoro-2-pyridinyl)-N'-(2-propylquinolin-4-yl)ethane-1,2-diamine.
Molecular Properties
| Compound Name | N-(5-fluoro-2-pyridinyl)-N'-(2-propylquinolin-4-yl)ethane-1,2-diamine |
| PubChem CID | 167935119 |
| Molecular Formula | C19H21FN4 |
| Molecular Weight | 324.40 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | N-(5-fluoro-2-pyridinyl)-N'-(2-propylquinolin-4-yl)ethane-1,2-diamine |
| SMILES | CCCc1cc(NCCNc2ccc(F)cn2)c2ccccc2n1 |
| InChI | InChI=1S/C19H21FN4/c1-2-5-15-12-18(16-6-3-4-7-17(16)24-15)21-10-11-22-19-9-8-14(20)13-23-19/h3-4,6-9,12-13H,2,5,10-11H2,1H3,(H,21,24)(H,22,23) |
| InChIKey | WZQOXJRAXWRVTN-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.40 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-(5-fluoro-2-pyridinyl)-N'-(2-propylquinolin-4-yl)ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-fluoro-2-pyridinyl)-N'-(2-propylquinolin-4-yl)ethane-1,2-diamine?
The IUPAC name of N-(5-fluoro-2-pyridinyl)-N'-(2-propylquinolin-4-yl)ethane-1,2-diamine (CID 167935119) is N-(5-fluoro-2-pyridinyl)-N'-(2-propylquinolin-4-yl)ethane-1,2-diamine.
What is the SMILES notation for N-(5-fluoro-2-pyridinyl)-N'-(2-propylquinolin-4-yl)ethane-1,2-diamine?
The canonical SMILES for N-(5-fluoro-2-pyridinyl)-N'-(2-propylquinolin-4-yl)ethane-1,2-diamine is CCCc1cc(NCCNc2ccc(F)cn2)c2ccccc2n1.
What is the InChIKey of N-(5-fluoro-2-pyridinyl)-N'-(2-propylquinolin-4-yl)ethane-1,2-diamine?
The InChIKey is WZQOXJRAXWRVTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21FN4/c1-2-5-15-12-18(16-6-3-4-7-17(16)24-15)21-10-11-22-19-9-8-14(20)13-23-19/h3-4,6-9,12-13H,2,5,10-11H2,1H3,(H,21,24)(H,22,23).
What are the key properties of N-(5-fluoro-2-pyridinyl)-N'-(2-propylquinolin-4-yl)ethane-1,2-diamine?
N-(5-fluoro-2-pyridinyl)-N'-(2-propylquinolin-4-yl)ethane-1,2-diamine has a molecular weight of 324.40 g/mol, XLogP of 4.25, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-fluoro-2-pyridinyl)-N'-(2-propylquinolin-4-yl)ethane-1,2-diamine is sourced from PubChem (CID 167935119), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).