About 1-[(3,5-dichloro-2-pyridinyl)methyl]-4-(4-fluorophenyl)tetrazol-5-one
1-[(3,5-dichloro-2-pyridinyl)methyl]-4-(4-fluorophenyl)tetrazol-5-one (PubChem CID 167936202) has the molecular formula C13H8Cl2FN5O
and a molecular weight of 340.15 g/mol. Its IUPAC name is 1-[(3,5-dichloro-2-pyridinyl)methyl]-4-(4-fluorophenyl)tetrazol-5-one.
Molecular Properties
| Compound Name | 1-[(3,5-dichloro-2-pyridinyl)methyl]-4-(4-fluorophenyl)tetrazol-5-one |
| PubChem CID | 167936202 |
| Molecular Formula | C13H8Cl2FN5O |
| Molecular Weight | 340.15 g/mol |
| Exact Mass | 339.01 |
| IUPAC Name | 1-[(3,5-dichloro-2-pyridinyl)methyl]-4-(4-fluorophenyl)tetrazol-5-one |
| SMILES | O=c1n(Cc2ncc(Cl)cc2Cl)nnn1-c1ccc(F)cc1 |
| InChI | InChI=1S/C13H8Cl2FN5O/c14-8-5-11(15)12(17-6-8)7-20-13(22)21(19-18-20)10-3-1-9(16)2-4-10/h1-6H,7H2 |
| InChIKey | DGNYEMPNNQRRLI-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 65.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.15 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[(3,5-dichloro-2-pyridinyl)methyl]-4-(4-fluorophenyl)tetrazol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3,5-dichloro-2-pyridinyl)methyl]-4-(4-fluorophenyl)tetrazol-5-one?
The IUPAC name of 1-[(3,5-dichloro-2-pyridinyl)methyl]-4-(4-fluorophenyl)tetrazol-5-one (CID 167936202) is 1-[(3,5-dichloro-2-pyridinyl)methyl]-4-(4-fluorophenyl)tetrazol-5-one.
What is the SMILES notation for 1-[(3,5-dichloro-2-pyridinyl)methyl]-4-(4-fluorophenyl)tetrazol-5-one?
The canonical SMILES for 1-[(3,5-dichloro-2-pyridinyl)methyl]-4-(4-fluorophenyl)tetrazol-5-one is O=c1n(Cc2ncc(Cl)cc2Cl)nnn1-c1ccc(F)cc1.
What is the InChIKey of 1-[(3,5-dichloro-2-pyridinyl)methyl]-4-(4-fluorophenyl)tetrazol-5-one?
The InChIKey is DGNYEMPNNQRRLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8Cl2FN5O/c14-8-5-11(15)12(17-6-8)7-20-13(22)21(19-18-20)10-3-1-9(16)2-4-10/h1-6H,7H2.
What are the key properties of 1-[(3,5-dichloro-2-pyridinyl)methyl]-4-(4-fluorophenyl)tetrazol-5-one?
1-[(3,5-dichloro-2-pyridinyl)methyl]-4-(4-fluorophenyl)tetrazol-5-one has a molecular weight of 340.15 g/mol, XLogP of 2.32, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3,5-dichloro-2-pyridinyl)methyl]-4-(4-fluorophenyl)tetrazol-5-one is sourced from PubChem (CID 167936202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).