C21H20N2O4 — CID 167936805
2,3-dihydroxy-4-methyl-N-[1-(4-pyridin-3-yloxyphenyl)ethyl]benzamide (PubChem CID 167936805) has the molecular formula C21H20N2O4 and a molecular weight of 364.40 g/mol. Its IUPAC name is 2,3-dihydroxy-4-methyl-N-[1-(4-pyridin-3-yloxyphenyl)ethyl]benzamide.
| Compound Name | 2,3-dihydroxy-4-methyl-N-[1-(4-pyridin-3-yloxyphenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 167936805 |
| Molecular Formula | C21H20N2O4 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | 2,3-dihydroxy-4-methyl-N-[1-(4-pyridin-3-yloxyphenyl)ethyl]benzamide |
| SMILES | Cc1ccc(C(=O)NC(C)c2ccc(Oc3cccnc3)cc2)c(O)c1O |
| InChI | InChI=1S/C21H20N2O4/c1-13-5-10-18(20(25)19(13)24)21(26)23-14(2)15-6-8-16(9-7-15)27-17-4-3-11-22-12-17/h3-12,14,24-25H,1-2H3,(H,23,26) |
| InChIKey | VFOUXUREQMAJTJ-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 91.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|