About 9-(cyclohexylmethyl)-3,9-diazabicyclo[3.3.1]nonan-2-one
9-(cyclohexylmethyl)-3,9-diazabicyclo[3.3.1]nonan-2-one (PubChem CID 167937397) has the molecular formula C14H24N2O
and a molecular weight of 236.36 g/mol. Its IUPAC name is 9-(cyclohexylmethyl)-3,9-diazabicyclo[3.3.1]nonan-2-one.
Molecular Properties
| Compound Name | 9-(cyclohexylmethyl)-3,9-diazabicyclo[3.3.1]nonan-2-one |
| PubChem CID | 167937397 |
| Molecular Formula | C14H24N2O |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.19 |
| IUPAC Name | 9-(cyclohexylmethyl)-3,9-diazabicyclo[3.3.1]nonan-2-one |
| SMILES | O=C1NCC2CCCC1N2CC1CCCCC1 |
| InChI | InChI=1S/C14H24N2O/c17-14-13-8-4-7-12(9-15-14)16(13)10-11-5-2-1-3-6-11/h11-13H,1-10H2,(H,15,17) |
| InChIKey | FNTPHUGCQDZTGZ-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 9-(cyclohexylmethyl)-3,9-diazabicyclo[3.3.1]nonan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-(cyclohexylmethyl)-3,9-diazabicyclo[3.3.1]nonan-2-one?
The IUPAC name of 9-(cyclohexylmethyl)-3,9-diazabicyclo[3.3.1]nonan-2-one (CID 167937397) is 9-(cyclohexylmethyl)-3,9-diazabicyclo[3.3.1]nonan-2-one.
What is the SMILES notation for 9-(cyclohexylmethyl)-3,9-diazabicyclo[3.3.1]nonan-2-one?
The canonical SMILES for 9-(cyclohexylmethyl)-3,9-diazabicyclo[3.3.1]nonan-2-one is O=C1NCC2CCCC1N2CC1CCCCC1.
What is the InChIKey of 9-(cyclohexylmethyl)-3,9-diazabicyclo[3.3.1]nonan-2-one?
The InChIKey is FNTPHUGCQDZTGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24N2O/c17-14-13-8-4-7-12(9-15-14)16(13)10-11-5-2-1-3-6-11/h11-13H,1-10H2,(H,15,17).
What are the key properties of 9-(cyclohexylmethyl)-3,9-diazabicyclo[3.3.1]nonan-2-one?
9-(cyclohexylmethyl)-3,9-diazabicyclo[3.3.1]nonan-2-one has a molecular weight of 236.36 g/mol, XLogP of 1.92, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9-(cyclohexylmethyl)-3,9-diazabicyclo[3.3.1]nonan-2-one is sourced from PubChem (CID 167937397), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).