C14H17ClN2O3 — CID 167937524
N-(2-chloro-3-methylphenyl)-N'-cyclopropyl-N'-(2-hydroxyethyl)oxamide (PubChem CID 167937524) has the molecular formula C14H17ClN2O3 and a molecular weight of 296.75 g/mol. Its IUPAC name is N-(2-chloro-3-methylphenyl)-N'-cyclopropyl-N'-(2-hydroxyethyl)oxamide.
| Compound Name | N-(2-chloro-3-methylphenyl)-N'-cyclopropyl-N'-(2-hydroxyethyl)oxamide |
|---|---|
| PubChem CID | 167937524 |
| Molecular Formula | C14H17ClN2O3 |
| Molecular Weight | 296.75 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | N-(2-chloro-3-methylphenyl)-N'-cyclopropyl-N'-(2-hydroxyethyl)oxamide |
| SMILES | Cc1cccc(NC(=O)C(=O)N(CCO)C2CC2)c1Cl |
| InChI | InChI=1S/C14H17ClN2O3/c1-9-3-2-4-11(12(9)15)16-13(19)14(20)17(7-8-18)10-5-6-10/h2-4,10,18H,5-8H2,1H3,(H,16,19) |
| InChIKey | UHXJHHUGYLYURG-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.75 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|