C19H19N5O2 — CID 167937639
N-methyl-2-[3-[3-(6-methylimidazo[1,2-a]pyridin-3-yl)-1,2,4-oxadiazol-5-yl]phenoxy]ethanamine (PubChem CID 167937639) has the molecular formula C19H19N5O2 and a molecular weight of 349.39 g/mol. Its IUPAC name is N-methyl-2-[3-[3-(6-methylimidazo[1,2-a]pyridin-3-yl)-1,2,4-oxadiazol-5-yl]phenoxy]ethanamine.
| Compound Name | N-methyl-2-[3-[3-(6-methylimidazo[1,2-a]pyridin-3-yl)-1,2,4-oxadiazol-5-yl]phenoxy]ethanamine |
|---|---|
| PubChem CID | 167937639 |
| Molecular Formula | C19H19N5O2 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | N-methyl-2-[3-[3-(6-methylimidazo[1,2-a]pyridin-3-yl)-1,2,4-oxadiazol-5-yl]phenoxy]ethanamine |
| SMILES | CNCCOc1cccc(-c2nc(-c3cnc4ccc(C)cn34)no2)c1 |
| InChI | InChI=1S/C19H19N5O2/c1-13-6-7-17-21-11-16(24(17)12-13)18-22-19(26-23-18)14-4-3-5-15(10-14)25-9-8-20-2/h3-7,10-12,20H,8-9H2,1-2H3 |
| InChIKey | CCBXSRXQPVPFSO-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 77.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|