C10H16F3NO3 — CID 16793855
7-(2,2,2-trifluoroethoxy)-1,4-dioxaspiro[4.5]decan-8-amine (PubChem CID 16793855) has the molecular formula C10H16F3NO3 and a molecular weight of 255.24 g/mol. Its IUPAC name is 7-(2,2,2-trifluoroethoxy)-1,4-dioxaspiro[4.5]decan-8-amine.
| Compound Name | 7-(2,2,2-trifluoroethoxy)-1,4-dioxaspiro[4.5]decan-8-amine |
|---|---|
| PubChem CID | 16793855 |
| Molecular Formula | C10H16F3NO3 |
| Molecular Weight | 255.24 g/mol |
| Exact Mass | 255.11 |
| IUPAC Name | 7-(2,2,2-trifluoroethoxy)-1,4-dioxaspiro[4.5]decan-8-amine |
| SMILES | NC1CCC2(CC1OCC(F)(F)F)OCCO2 |
| InChI | InChI=1S/C10H16F3NO3/c11-10(12,13)6-15-8-5-9(2-1-7(8)14)16-3-4-17-9/h7-8H,1-6,14H2 |
| InChIKey | RCGKOPLXEVDFNL-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.24 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |