C12H17N5O3 — CID 167938890
[(1S,4R,5S,6R)-5,6-dihydroxy-2,3-diazabicyclo[2.2.1]heptan-2-yl]-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-7-yl)methanone (PubChem CID 167938890) has the molecular formula C12H17N5O3 and a molecular weight of 279.30 g/mol. Its IUPAC name is [(1S,4R,5S,6R)-5,6-dihydroxy-2,3-diazabicyclo[2.2.1]heptan-2-yl]-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-7-yl)methanone.
| Compound Name | [(1S,4R,5S,6R)-5,6-dihydroxy-2,3-diazabicyclo[2.2.1]heptan-2-yl]-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-7-yl)methanone |
|---|---|
| PubChem CID | 167938890 |
| Molecular Formula | C12H17N5O3 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | [(1S,4R,5S,6R)-5,6-dihydroxy-2,3-diazabicyclo[2.2.1]heptan-2-yl]-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-7-yl)methanone |
| SMILES | O=C(C1CCn2cnnc2C1)N1N[C@@H]2C[C@H]1[C@@H](O)[C@H]2O |
| InChI | InChI=1S/C12H17N5O3/c18-10-7-4-8(11(10)19)17(15-7)12(20)6-1-2-16-5-13-14-9(16)3-6/h5-8,10-11,15,18-19H,1-4H2/t6?,7-,8+,10+,11-/m1/s1 |
| InChIKey | ZXHNYFVDWJJQNQ-IYQYYYRRSA-N |
| XLogP | -1.95 |
| TPSA | 103.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | -1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |