C20H24N4O — CID 167939408
[4-(2-methylphenyl)-3,6-dihydro-2H-pyridin-1-yl]-(2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)methanone (PubChem CID 167939408) has the molecular formula C20H24N4O and a molecular weight of 336.44 g/mol. Its IUPAC name is [4-(2-methylphenyl)-3,6-dihydro-2H-pyridin-1-yl]-(2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)methanone.
| Compound Name | [4-(2-methylphenyl)-3,6-dihydro-2H-pyridin-1-yl]-(2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)methanone |
|---|---|
| PubChem CID | 167939408 |
| Molecular Formula | C20H24N4O |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | [4-(2-methylphenyl)-3,6-dihydro-2H-pyridin-1-yl]-(2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)methanone |
| SMILES | Cc1nc2n(n1)CC(C(=O)N1CC=C(c3ccccc3C)CC1)CC2 |
| InChI | InChI=1S/C20H24N4O/c1-14-5-3-4-6-18(14)16-9-11-23(12-10-16)20(25)17-7-8-19-21-15(2)22-24(19)13-17/h3-6,9,17H,7-8,10-13H2,1-2H3 |
| InChIKey | LKNNQSKMBASTFX-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |