About 4-methyl-2-oxo-3H-1,3-thiazole-5-sulfonamide
4-methyl-2-oxo-3H-1,3-thiazole-5-sulfonamide (PubChem CID 16794146) has the molecular formula C4H6N2O3S2
and a molecular weight of 194.24 g/mol. Its IUPAC name is 4-methyl-2-oxo-3H-1,3-thiazole-5-sulfonamide.
Molecular Properties
| Compound Name | 4-methyl-2-oxo-3H-1,3-thiazole-5-sulfonamide |
| PubChem CID | 16794146 |
| Molecular Formula | C4H6N2O3S2 |
| Molecular Weight | 194.24 g/mol |
| Exact Mass | 193.98 |
| IUPAC Name | 4-methyl-2-oxo-3H-1,3-thiazole-5-sulfonamide |
| SMILES | Cc1[nH]c(=O)sc1S(N)(=O)=O |
| InChI | InChI=1S/C4H6N2O3S2/c1-2-3(11(5,8)9)10-4(7)6-2/h1H3,(H,6,7)(H2,5,8,9) |
| InChIKey | SBZLUIOIMPWREJ-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 93.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.24 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-methyl-2-oxo-3H-1,3-thiazole-5-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-2-oxo-3H-1,3-thiazole-5-sulfonamide?
The IUPAC name of 4-methyl-2-oxo-3H-1,3-thiazole-5-sulfonamide (CID 16794146) is 4-methyl-2-oxo-3H-1,3-thiazole-5-sulfonamide.
What is the SMILES notation for 4-methyl-2-oxo-3H-1,3-thiazole-5-sulfonamide?
The canonical SMILES for 4-methyl-2-oxo-3H-1,3-thiazole-5-sulfonamide is Cc1[nH]c(=O)sc1S(N)(=O)=O.
What is the InChIKey of 4-methyl-2-oxo-3H-1,3-thiazole-5-sulfonamide?
The InChIKey is SBZLUIOIMPWREJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6N2O3S2/c1-2-3(11(5,8)9)10-4(7)6-2/h1H3,(H,6,7)(H2,5,8,9).
What are the key properties of 4-methyl-2-oxo-3H-1,3-thiazole-5-sulfonamide?
4-methyl-2-oxo-3H-1,3-thiazole-5-sulfonamide has a molecular weight of 194.24 g/mol, XLogP of -0.61, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-2-oxo-3H-1,3-thiazole-5-sulfonamide is sourced from PubChem (CID 16794146), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).