C14H11F3N2OS — CID 167941941
(E)-4,4,4-trifluoro-N-[[4-(1,3-thiazol-2-yl)phenyl]methyl]but-2-enamide (PubChem CID 167941941) has the molecular formula C14H11F3N2OS and a molecular weight of 312.32 g/mol. Its IUPAC name is (E)-4,4,4-trifluoro-N-[[4-(1,3-thiazol-2-yl)phenyl]methyl]but-2-enamide.
| Compound Name | (E)-4,4,4-trifluoro-N-[[4-(1,3-thiazol-2-yl)phenyl]methyl]but-2-enamide |
|---|---|
| PubChem CID | 167941941 |
| Molecular Formula | C14H11F3N2OS |
| Molecular Weight | 312.32 g/mol |
| Exact Mass | 312.05 |
| IUPAC Name | (E)-4,4,4-trifluoro-N-[[4-(1,3-thiazol-2-yl)phenyl]methyl]but-2-enamide |
| SMILES | O=C(/C=C/C(F)(F)F)NCc1ccc(-c2nccs2)cc1 |
| InChI | InChI=1S/C14H11F3N2OS/c15-14(16,17)6-5-12(20)19-9-10-1-3-11(4-2-10)13-18-7-8-21-13/h1-8H,9H2,(H,19,20)/b6-5+ |
| InChIKey | SBLNSIRFQUNULD-AATRIKPKSA-N |
| XLogP | 3.54 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.32 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|