C13H14FN3O2 — CID 167942183
N-[5-[[(E)-4-fluorobut-2-enoyl]amino]-2-pyridinyl]cyclopropanecarboxamide (PubChem CID 167942183) has the molecular formula C13H14FN3O2 and a molecular weight of 263.27 g/mol. Its IUPAC name is N-[5-[[(E)-4-fluorobut-2-enoyl]amino]-2-pyridinyl]cyclopropanecarboxamide.
| Compound Name | N-[5-[[(E)-4-fluorobut-2-enoyl]amino]-2-pyridinyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 167942183 |
| Molecular Formula | C13H14FN3O2 |
| Molecular Weight | 263.27 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | N-[5-[[(E)-4-fluorobut-2-enoyl]amino]-2-pyridinyl]cyclopropanecarboxamide |
| SMILES | O=C(/C=C/CF)Nc1ccc(NC(=O)C2CC2)nc1 |
| InChI | InChI=1S/C13H14FN3O2/c14-7-1-2-12(18)16-10-5-6-11(15-8-10)17-13(19)9-3-4-9/h1-2,5-6,8-9H,3-4,7H2,(H,16,18)(H,15,17,19)/b2-1+ |
| InChIKey | KJBIZQHFAOVEMW-OWOJBTEDSA-N |
| XLogP | 1.89 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.27 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|