C16H21F2N3 — CID 167942426
N-[1-(2,6-difluorophenyl)ethyl]-6-methyl-1,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyridin-3-amine (PubChem CID 167942426) has the molecular formula C16H21F2N3 and a molecular weight of 293.36 g/mol. Its IUPAC name is N-[1-(2,6-difluorophenyl)ethyl]-6-methyl-1,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyridin-3-amine.
| Compound Name | N-[1-(2,6-difluorophenyl)ethyl]-6-methyl-1,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyridin-3-amine |
|---|---|
| PubChem CID | 167942426 |
| Molecular Formula | C16H21F2N3 |
| Molecular Weight | 293.36 g/mol |
| Exact Mass | 293.17 |
| IUPAC Name | N-[1-(2,6-difluorophenyl)ethyl]-6-methyl-1,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyridin-3-amine |
| SMILES | CC1CCC2CN=C(NC(C)c3c(F)cccc3F)N2C1 |
| InChI | InChI=1S/C16H21F2N3/c1-10-6-7-12-8-19-16(21(12)9-10)20-11(2)15-13(17)4-3-5-14(15)18/h3-5,10-12H,6-9H2,1-2H3,(H,19,20) |
| InChIKey | PFJFGKVNVQJDGP-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.36 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |