C14H17F3IN3O3S — CID 167942948
1-(3-iodophenyl)sulfonyl-3-[1-(2,2,2-trifluoroethyl)piperidin-3-yl]urea (PubChem CID 167942948) has the molecular formula C14H17F3IN3O3S and a molecular weight of 491.27 g/mol. Its IUPAC name is 1-(3-iodophenyl)sulfonyl-3-[1-(2,2,2-trifluoroethyl)piperidin-3-yl]urea.
| Compound Name | 1-(3-iodophenyl)sulfonyl-3-[1-(2,2,2-trifluoroethyl)piperidin-3-yl]urea |
|---|---|
| PubChem CID | 167942948 |
| Molecular Formula | C14H17F3IN3O3S |
| Molecular Weight | 491.27 g/mol |
| Exact Mass | 491.00 |
| IUPAC Name | 1-(3-iodophenyl)sulfonyl-3-[1-(2,2,2-trifluoroethyl)piperidin-3-yl]urea |
| SMILES | O=C(NC1CCCN(CC(F)(F)F)C1)NS(=O)(=O)c1cccc(I)c1 |
| InChI | InChI=1S/C14H17F3IN3O3S/c15-14(16,17)9-21-6-2-4-11(8-21)19-13(22)20-25(23,24)12-5-1-3-10(18)7-12/h1,3,5,7,11H,2,4,6,8-9H2,(H2,19,20,22) |
| InChIKey | WSTTYVLOXRTVEC-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.27 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|