C18H10F3N5O3S — CID 167943582
6-[3-[5-[3-(trifluoromethyl)phenyl]-1,3-oxazol-4-yl]-1,2,4-oxadiazol-5-yl]-2,3-dihydro-[1,3]thiazolo[3,2-a]pyrimidin-5-one (PubChem CID 167943582) has the molecular formula C18H10F3N5O3S and a molecular weight of 433.37 g/mol. Its IUPAC name is 6-[3-[5-[3-(trifluoromethyl)phenyl]-1,3-oxazol-4-yl]-1,2,4-oxadiazol-5-yl]-2,3-dihydro-[1,3]thiazolo[3,2-a]pyrimidin-5-one.
| Compound Name | 6-[3-[5-[3-(trifluoromethyl)phenyl]-1,3-oxazol-4-yl]-1,2,4-oxadiazol-5-yl]-2,3-dihydro-[1,3]thiazolo[3,2-a]pyrimidin-5-one |
|---|---|
| PubChem CID | 167943582 |
| Molecular Formula | C18H10F3N5O3S |
| Molecular Weight | 433.37 g/mol |
| Exact Mass | 433.05 |
| IUPAC Name | 6-[3-[5-[3-(trifluoromethyl)phenyl]-1,3-oxazol-4-yl]-1,2,4-oxadiazol-5-yl]-2,3-dihydro-[1,3]thiazolo[3,2-a]pyrimidin-5-one |
| SMILES | O=c1c(-c2nc(-c3ncoc3-c3cccc(C(F)(F)F)c3)no2)cnc2n1CCS2 |
| InChI | InChI=1S/C18H10F3N5O3S/c19-18(20,21)10-3-1-2-9(6-10)13-12(23-8-28-13)14-24-15(29-25-14)11-7-22-17-26(16(11)27)4-5-30-17/h1-3,6-8H,4-5H2 |
| InChIKey | NRAZTEUTPGPZTD-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 99.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.37 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |