About 1-[1-(1,3-dimethylpyrazol-4-yl)ethyl]-3-[2-methyl-2-(6-oxopiperidin-2-yl)propyl]urea
1-[1-(1,3-dimethylpyrazol-4-yl)ethyl]-3-[2-methyl-2-(6-oxopiperidin-2-yl)propyl]urea (PubChem CID 167944036) has the molecular formula C17H29N5O2
and a molecular weight of 335.45 g/mol. Its IUPAC name is 1-[1-(1,3-dimethylpyrazol-4-yl)ethyl]-3-[2-methyl-2-(6-oxopiperidin-2-yl)propyl]urea.
Molecular Properties
| Compound Name | 1-[1-(1,3-dimethylpyrazol-4-yl)ethyl]-3-[2-methyl-2-(6-oxopiperidin-2-yl)propyl]urea |
| PubChem CID | 167944036 |
| Molecular Formula | C17H29N5O2 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.23 |
| IUPAC Name | 1-[1-(1,3-dimethylpyrazol-4-yl)ethyl]-3-[2-methyl-2-(6-oxopiperidin-2-yl)propyl]urea |
| SMILES | Cc1nn(C)cc1C(C)NC(=O)NCC(C)(C)C1CCCC(=O)N1 |
| InChI | InChI=1S/C17H29N5O2/c1-11(13-9-22(5)21-12(13)2)19-16(24)18-10-17(3,4)14-7-6-8-15(23)20-14/h9,11,14H,6-8,10H2,1-5H3,(H,20,23)(H2,18,19,24) |
| InChIKey | ULXBBSINCYBSGB-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 88.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[1-(1,3-dimethylpyrazol-4-yl)ethyl]-3-[2-methyl-2-(6-oxopiperidin-2-yl)propyl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1-(1,3-dimethylpyrazol-4-yl)ethyl]-3-[2-methyl-2-(6-oxopiperidin-2-yl)propyl]urea?
The IUPAC name of 1-[1-(1,3-dimethylpyrazol-4-yl)ethyl]-3-[2-methyl-2-(6-oxopiperidin-2-yl)propyl]urea (CID 167944036) is 1-[1-(1,3-dimethylpyrazol-4-yl)ethyl]-3-[2-methyl-2-(6-oxopiperidin-2-yl)propyl]urea.
What is the SMILES notation for 1-[1-(1,3-dimethylpyrazol-4-yl)ethyl]-3-[2-methyl-2-(6-oxopiperidin-2-yl)propyl]urea?
The canonical SMILES for 1-[1-(1,3-dimethylpyrazol-4-yl)ethyl]-3-[2-methyl-2-(6-oxopiperidin-2-yl)propyl]urea is Cc1nn(C)cc1C(C)NC(=O)NCC(C)(C)C1CCCC(=O)N1.
What is the InChIKey of 1-[1-(1,3-dimethylpyrazol-4-yl)ethyl]-3-[2-methyl-2-(6-oxopiperidin-2-yl)propyl]urea?
The InChIKey is ULXBBSINCYBSGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H29N5O2/c1-11(13-9-22(5)21-12(13)2)19-16(24)18-10-17(3,4)14-7-6-8-15(23)20-14/h9,11,14H,6-8,10H2,1-5H3,(H,20,23)(H2,18,19,24).
What are the key properties of 1-[1-(1,3-dimethylpyrazol-4-yl)ethyl]-3-[2-methyl-2-(6-oxopiperidin-2-yl)propyl]urea?
1-[1-(1,3-dimethylpyrazol-4-yl)ethyl]-3-[2-methyl-2-(6-oxopiperidin-2-yl)propyl]urea has a molecular weight of 335.45 g/mol, XLogP of 1.78, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1-(1,3-dimethylpyrazol-4-yl)ethyl]-3-[2-methyl-2-(6-oxopiperidin-2-yl)propyl]urea is sourced from PubChem (CID 167944036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).