C17H15BrFN3O2 — CID 167944080
5-(4-bromophenyl)-3-(5-fluoro-3-pyridinyl)-1-propan-2-ylimidazolidine-2,4-dione (PubChem CID 167944080) has the molecular formula C17H15BrFN3O2 and a molecular weight of 392.23 g/mol. Its IUPAC name is 5-(4-bromophenyl)-3-(5-fluoro-3-pyridinyl)-1-propan-2-ylimidazolidine-2,4-dione.
| Compound Name | 5-(4-bromophenyl)-3-(5-fluoro-3-pyridinyl)-1-propan-2-ylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 167944080 |
| Molecular Formula | C17H15BrFN3O2 |
| Molecular Weight | 392.23 g/mol |
| Exact Mass | 391.03 |
| IUPAC Name | 5-(4-bromophenyl)-3-(5-fluoro-3-pyridinyl)-1-propan-2-ylimidazolidine-2,4-dione |
| SMILES | CC(C)N1C(=O)N(c2cncc(F)c2)C(=O)C1c1ccc(Br)cc1 |
| InChI | InChI=1S/C17H15BrFN3O2/c1-10(2)21-15(11-3-5-12(18)6-4-11)16(23)22(17(21)24)14-7-13(19)8-20-9-14/h3-10,15H,1-2H3 |
| InChIKey | VALYGGKTCSEZAN-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.23 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|