About 2-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl-(oxan-4-yl)amino]acetamide
2-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl-(oxan-4-yl)amino]acetamide (PubChem CID 167944913) has the molecular formula C15H19ClN4O2
and a molecular weight of 322.80 g/mol. Its IUPAC name is 2-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl-(oxan-4-yl)amino]acetamide.
Molecular Properties
| Compound Name | 2-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl-(oxan-4-yl)amino]acetamide |
| PubChem CID | 167944913 |
| Molecular Formula | C15H19ClN4O2 |
| Molecular Weight | 322.80 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | 2-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl-(oxan-4-yl)amino]acetamide |
| SMILES | NC(=O)CN(Cc1cn2cc(Cl)ccc2n1)C1CCOCC1 |
| InChI | InChI=1S/C15H19ClN4O2/c16-11-1-2-15-18-12(9-20(15)7-11)8-19(10-14(17)21)13-3-5-22-6-4-13/h1-2,7,9,13H,3-6,8,10H2,(H2,17,21) |
| InChIKey | VGNKJGAULWWPKE-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 72.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.80 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl-(oxan-4-yl)amino]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl-(oxan-4-yl)amino]acetamide?
The IUPAC name of 2-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl-(oxan-4-yl)amino]acetamide (CID 167944913) is 2-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl-(oxan-4-yl)amino]acetamide.
What is the SMILES notation for 2-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl-(oxan-4-yl)amino]acetamide?
The canonical SMILES for 2-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl-(oxan-4-yl)amino]acetamide is NC(=O)CN(Cc1cn2cc(Cl)ccc2n1)C1CCOCC1.
What is the InChIKey of 2-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl-(oxan-4-yl)amino]acetamide?
The InChIKey is VGNKJGAULWWPKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19ClN4O2/c16-11-1-2-15-18-12(9-20(15)7-11)8-19(10-14(17)21)13-3-5-22-6-4-13/h1-2,7,9,13H,3-6,8,10H2,(H2,17,21).
What are the key properties of 2-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl-(oxan-4-yl)amino]acetamide?
2-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl-(oxan-4-yl)amino]acetamide has a molecular weight of 322.80 g/mol, XLogP of 1.45, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl-(oxan-4-yl)amino]acetamide is sourced from PubChem (CID 167944913), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).