C11H9F3N2O4S — CID 167944942
N-[4-oxo-8-(trifluoromethoxy)-1H-quinolin-3-yl]methanesulfonamide (PubChem CID 167944942) has the molecular formula C11H9F3N2O4S and a molecular weight of 322.26 g/mol. Its IUPAC name is N-[4-oxo-8-(trifluoromethoxy)-1H-quinolin-3-yl]methanesulfonamide.
| Compound Name | N-[4-oxo-8-(trifluoromethoxy)-1H-quinolin-3-yl]methanesulfonamide |
|---|---|
| PubChem CID | 167944942 |
| Molecular Formula | C11H9F3N2O4S |
| Molecular Weight | 322.26 g/mol |
| Exact Mass | 322.02 |
| IUPAC Name | N-[4-oxo-8-(trifluoromethoxy)-1H-quinolin-3-yl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1c[nH]c2c(OC(F)(F)F)cccc2c1=O |
| InChI | InChI=1S/C11H9F3N2O4S/c1-21(18,19)16-7-5-15-9-6(10(7)17)3-2-4-8(9)20-11(12,13)14/h2-5,16H,1H3,(H,15,17) |
| InChIKey | URPVPUWSYIFDOU-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 88.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.26 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |