C17H18O4S — CID 167945928
4-methyl-5-[2-(oxolan-3-ylmethoxy)phenyl]thiophene-2-carboxylic acid (PubChem CID 167945928) has the molecular formula C17H18O4S and a molecular weight of 318.39 g/mol. Its IUPAC name is 4-methyl-5-[2-(oxolan-3-ylmethoxy)phenyl]thiophene-2-carboxylic acid.
| Compound Name | 4-methyl-5-[2-(oxolan-3-ylmethoxy)phenyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 167945928 |
| Molecular Formula | C17H18O4S |
| Molecular Weight | 318.39 g/mol |
| Exact Mass | 318.09 |
| IUPAC Name | 4-methyl-5-[2-(oxolan-3-ylmethoxy)phenyl]thiophene-2-carboxylic acid |
| SMILES | Cc1cc(C(=O)O)sc1-c1ccccc1OCC1CCOC1 |
| InChI | InChI=1S/C17H18O4S/c1-11-8-15(17(18)19)22-16(11)13-4-2-3-5-14(13)21-10-12-6-7-20-9-12/h2-5,8,12H,6-7,9-10H2,1H3,(H,18,19) |
| InChIKey | PDNLGPBKAXNHGZ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.39 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |