C24H25N5O4 — CID 167946058
N-(1,3-benzodioxol-5-yl)-N-[(2-prop-2-enoxyphenyl)methyl]-2-(2,5,6,7-tetrahydrotriazolo[4,5-b]pyridin-4-yl)acetamide (PubChem CID 167946058) has the molecular formula C24H25N5O4 and a molecular weight of 447.50 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-N-[(2-prop-2-enoxyphenyl)methyl]-2-(2,5,6,7-tetrahydrotriazolo[4,5-b]pyridin-4-yl)acetamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-N-[(2-prop-2-enoxyphenyl)methyl]-2-(2,5,6,7-tetrahydrotriazolo[4,5-b]pyridin-4-yl)acetamide |
|---|---|
| PubChem CID | 167946058 |
| Molecular Formula | C24H25N5O4 |
| Molecular Weight | 447.50 g/mol |
| Exact Mass | 447.19 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-N-[(2-prop-2-enoxyphenyl)methyl]-2-(2,5,6,7-tetrahydrotriazolo[4,5-b]pyridin-4-yl)acetamide |
| SMILES | C=CCOc1ccccc1CN(C(=O)CN1CCCc2n[nH]nc21)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C24H25N5O4/c1-2-12-31-20-8-4-3-6-17(20)14-29(18-9-10-21-22(13-18)33-16-32-21)23(30)15-28-11-5-7-19-24(28)26-27-25-19/h2-4,6,8-10,13H,1,5,7,11-12,14-16H2,(H,25,26,27) |
| InChIKey | UUYLGBNUZKZBIY-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 92.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.50 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|