C17H21FN2O3 — CID 167946561
5-[(4-fluorophenyl)methyl]-3-[2-(2-methylprop-2-enoxy)ethyl]-1,3-diazinane-2,4-dione (PubChem CID 167946561) has the molecular formula C17H21FN2O3 and a molecular weight of 320.36 g/mol. Its IUPAC name is 5-[(4-fluorophenyl)methyl]-3-[2-(2-methylprop-2-enoxy)ethyl]-1,3-diazinane-2,4-dione.
| Compound Name | 5-[(4-fluorophenyl)methyl]-3-[2-(2-methylprop-2-enoxy)ethyl]-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 167946561 |
| Molecular Formula | C17H21FN2O3 |
| Molecular Weight | 320.36 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | 5-[(4-fluorophenyl)methyl]-3-[2-(2-methylprop-2-enoxy)ethyl]-1,3-diazinane-2,4-dione |
| SMILES | C=C(C)COCCN1C(=O)NCC(Cc2ccc(F)cc2)C1=O |
| InChI | InChI=1S/C17H21FN2O3/c1-12(2)11-23-8-7-20-16(21)14(10-19-17(20)22)9-13-3-5-15(18)6-4-13/h3-6,14H,1,7-11H2,2H3,(H,19,22) |
| InChIKey | FECNGGXKGZPSLG-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.36 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|