C13H17N3O5 — CID 167946600
N-[(3S,3aR,6S,6aR)-3-acetamido-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]-2-methyl-1,3-oxazole-5-carboxamide (PubChem CID 167946600) has the molecular formula C13H17N3O5 and a molecular weight of 295.30 g/mol. Its IUPAC name is N-[(3S,3aR,6S,6aR)-3-acetamido-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]-2-methyl-1,3-oxazole-5-carboxamide.
| Compound Name | N-[(3S,3aR,6S,6aR)-3-acetamido-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]-2-methyl-1,3-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 167946600 |
| Molecular Formula | C13H17N3O5 |
| Molecular Weight | 295.30 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | N-[(3S,3aR,6S,6aR)-3-acetamido-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]-2-methyl-1,3-oxazole-5-carboxamide |
| SMILES | CC(=O)N[C@H]1CO[C@H]2[C@@H]1OC[C@@H]2NC(=O)c1cnc(C)o1 |
| InChI | InChI=1S/C13H17N3O5/c1-6(17)15-8-4-19-12-9(5-20-11(8)12)16-13(18)10-3-14-7(2)21-10/h3,8-9,11-12H,4-5H2,1-2H3,(H,15,17)(H,16,18)/t8-,9-,11+,12+/m0/s1 |
| InChIKey | ROCNORBQZSXCNE-GAIPPQHRSA-N |
| XLogP | -0.62 |
| TPSA | 102.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.30 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |