C8H3F2NO2 — CID 16794671
5,7-difluoro-1H-indole-2,3-dione (PubChem CID 16794671) has the molecular formula C8H3F2NO2 and a molecular weight of 183.11 g/mol. Its IUPAC name is 5,7-difluoro-1H-indole-2,3-dione.
| Compound Name | 5,7-difluoro-1H-indole-2,3-dione |
|---|---|
| PubChem CID | 16794671 |
| Molecular Formula | C8H3F2NO2 |
| Molecular Weight | 183.11 g/mol |
| Exact Mass | 183.01 |
| IUPAC Name | 5,7-difluoro-1H-indole-2,3-dione |
| SMILES | O=C1Nc2c(F)cc(F)cc2C1=O |
| InChI | InChI=1S/C8H3F2NO2/c9-3-1-4-6(5(10)2-3)11-8(13)7(4)12/h1-2H,(H,11,12,13) |
| InChIKey | LGOCJGRNNIZUBL-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.11 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|