About [1-(2-fluorophenyl)-2-methoxy-2-oxoethyl] 1H-pyrrolo[2,3-b]pyridine-4-carboxylate
[1-(2-fluorophenyl)-2-methoxy-2-oxoethyl] 1H-pyrrolo[2,3-b]pyridine-4-carboxylate (PubChem CID 167947176) has the molecular formula C17H13FN2O4
and a molecular weight of 328.30 g/mol. Its IUPAC name is [1-(2-fluorophenyl)-2-methoxy-2-oxoethyl] 1H-pyrrolo[2,3-b]pyridine-4-carboxylate.
Molecular Properties
| Compound Name | [1-(2-fluorophenyl)-2-methoxy-2-oxoethyl] 1H-pyrrolo[2,3-b]pyridine-4-carboxylate |
| PubChem CID | 167947176 |
| Molecular Formula | C17H13FN2O4 |
| Molecular Weight | 328.30 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | [1-(2-fluorophenyl)-2-methoxy-2-oxoethyl] 1H-pyrrolo[2,3-b]pyridine-4-carboxylate |
| SMILES | COC(=O)C(OC(=O)c1ccnc2[nH]ccc12)c1ccccc1F |
| InChI | InChI=1S/C17H13FN2O4/c1-23-17(22)14(12-4-2-3-5-13(12)18)24-16(21)11-7-9-20-15-10(11)6-8-19-15/h2-9,14H,1H3,(H,19,20) |
| InChIKey | YTOILZPMDUFQOY-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 81.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.30 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [1-(2-fluorophenyl)-2-methoxy-2-oxoethyl] 1H-pyrrolo[2,3-b]pyridine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(2-fluorophenyl)-2-methoxy-2-oxoethyl] 1H-pyrrolo[2,3-b]pyridine-4-carboxylate?
The IUPAC name of [1-(2-fluorophenyl)-2-methoxy-2-oxoethyl] 1H-pyrrolo[2,3-b]pyridine-4-carboxylate (CID 167947176) is [1-(2-fluorophenyl)-2-methoxy-2-oxoethyl] 1H-pyrrolo[2,3-b]pyridine-4-carboxylate.
What is the SMILES notation for [1-(2-fluorophenyl)-2-methoxy-2-oxoethyl] 1H-pyrrolo[2,3-b]pyridine-4-carboxylate?
The canonical SMILES for [1-(2-fluorophenyl)-2-methoxy-2-oxoethyl] 1H-pyrrolo[2,3-b]pyridine-4-carboxylate is COC(=O)C(OC(=O)c1ccnc2[nH]ccc12)c1ccccc1F.
What is the InChIKey of [1-(2-fluorophenyl)-2-methoxy-2-oxoethyl] 1H-pyrrolo[2,3-b]pyridine-4-carboxylate?
The InChIKey is YTOILZPMDUFQOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13FN2O4/c1-23-17(22)14(12-4-2-3-5-13(12)18)24-16(21)11-7-9-20-15-10(11)6-8-19-15/h2-9,14H,1H3,(H,19,20).
What are the key properties of [1-(2-fluorophenyl)-2-methoxy-2-oxoethyl] 1H-pyrrolo[2,3-b]pyridine-4-carboxylate?
[1-(2-fluorophenyl)-2-methoxy-2-oxoethyl] 1H-pyrrolo[2,3-b]pyridine-4-carboxylate has a molecular weight of 328.30 g/mol, XLogP of 2.77, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(2-fluorophenyl)-2-methoxy-2-oxoethyl] 1H-pyrrolo[2,3-b]pyridine-4-carboxylate is sourced from PubChem (CID 167947176), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).