About 3-[3-(5,6-dichlorobenzotriazol-1-yl)-2-hydroxypropyl]oxolan-3-ol
3-[3-(5,6-dichlorobenzotriazol-1-yl)-2-hydroxypropyl]oxolan-3-ol (PubChem CID 167947178) has the molecular formula C13H15Cl2N3O3
and a molecular weight of 332.19 g/mol. Its IUPAC name is 3-[3-(5,6-dichlorobenzotriazol-1-yl)-2-hydroxypropyl]oxolan-3-ol.
Molecular Properties
| Compound Name | 3-[3-(5,6-dichlorobenzotriazol-1-yl)-2-hydroxypropyl]oxolan-3-ol |
| PubChem CID | 167947178 |
| Molecular Formula | C13H15Cl2N3O3 |
| Molecular Weight | 332.19 g/mol |
| Exact Mass | 331.05 |
| IUPAC Name | 3-[3-(5,6-dichlorobenzotriazol-1-yl)-2-hydroxypropyl]oxolan-3-ol |
| SMILES | OC(Cn1nnc2cc(Cl)c(Cl)cc21)CC1(O)CCOC1 |
| InChI | InChI=1S/C13H15Cl2N3O3/c14-9-3-11-12(4-10(9)15)18(17-16-11)6-8(19)5-13(20)1-2-21-7-13/h3-4,8,19-20H,1-2,5-7H2 |
| InChIKey | PVUCKWRXTAGAQJ-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 80.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.19 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[3-(5,6-dichlorobenzotriazol-1-yl)-2-hydroxypropyl]oxolan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3-(5,6-dichlorobenzotriazol-1-yl)-2-hydroxypropyl]oxolan-3-ol?
The IUPAC name of 3-[3-(5,6-dichlorobenzotriazol-1-yl)-2-hydroxypropyl]oxolan-3-ol (CID 167947178) is 3-[3-(5,6-dichlorobenzotriazol-1-yl)-2-hydroxypropyl]oxolan-3-ol.
What is the SMILES notation for 3-[3-(5,6-dichlorobenzotriazol-1-yl)-2-hydroxypropyl]oxolan-3-ol?
The canonical SMILES for 3-[3-(5,6-dichlorobenzotriazol-1-yl)-2-hydroxypropyl]oxolan-3-ol is OC(Cn1nnc2cc(Cl)c(Cl)cc21)CC1(O)CCOC1.
What is the InChIKey of 3-[3-(5,6-dichlorobenzotriazol-1-yl)-2-hydroxypropyl]oxolan-3-ol?
The InChIKey is PVUCKWRXTAGAQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15Cl2N3O3/c14-9-3-11-12(4-10(9)15)18(17-16-11)6-8(19)5-13(20)1-2-21-7-13/h3-4,8,19-20H,1-2,5-7H2.
What are the key properties of 3-[3-(5,6-dichlorobenzotriazol-1-yl)-2-hydroxypropyl]oxolan-3-ol?
3-[3-(5,6-dichlorobenzotriazol-1-yl)-2-hydroxypropyl]oxolan-3-ol has a molecular weight of 332.19 g/mol, XLogP of 1.64, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-(5,6-dichlorobenzotriazol-1-yl)-2-hydroxypropyl]oxolan-3-ol is sourced from PubChem (CID 167947178), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).