About 9-bromo-2-propyl-3,4-dihydro-1H-benzo[b][1,6]naphthyridine-10-carboxylic acid
9-bromo-2-propyl-3,4-dihydro-1H-benzo[b][1,6]naphthyridine-10-carboxylic acid (PubChem CID 16794858) has the molecular formula C16H17BrN2O2
and a molecular weight of 349.23 g/mol. Its IUPAC name is 9-bromo-2-propyl-3,4-dihydro-1H-benzo[b][1,6]naphthyridine-10-carboxylic acid.
Molecular Properties
| Compound Name | 9-bromo-2-propyl-3,4-dihydro-1H-benzo[b][1,6]naphthyridine-10-carboxylic acid |
| PubChem CID | 16794858 |
| Molecular Formula | C16H17BrN2O2 |
| Molecular Weight | 349.23 g/mol |
| Exact Mass | 348.05 |
| IUPAC Name | 9-bromo-2-propyl-3,4-dihydro-1H-benzo[b][1,6]naphthyridine-10-carboxylic acid |
| SMILES | CCCN1CCc2nc3cccc(Br)c3c(C(=O)O)c2C1 |
| InChI | InChI=1S/C16H17BrN2O2/c1-2-7-19-8-6-12-10(9-19)14(16(20)21)15-11(17)4-3-5-13(15)18-12/h3-5H,2,6-9H2,1H3,(H,20,21) |
| InChIKey | ZNEMNQJGEJWOMS-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.23 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 9-bromo-2-propyl-3,4-dihydro-1H-benzo[b][1,6]naphthyridine-10-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-bromo-2-propyl-3,4-dihydro-1H-benzo[b][1,6]naphthyridine-10-carboxylic acid?
The IUPAC name of 9-bromo-2-propyl-3,4-dihydro-1H-benzo[b][1,6]naphthyridine-10-carboxylic acid (CID 16794858) is 9-bromo-2-propyl-3,4-dihydro-1H-benzo[b][1,6]naphthyridine-10-carboxylic acid.
What is the SMILES notation for 9-bromo-2-propyl-3,4-dihydro-1H-benzo[b][1,6]naphthyridine-10-carboxylic acid?
The canonical SMILES for 9-bromo-2-propyl-3,4-dihydro-1H-benzo[b][1,6]naphthyridine-10-carboxylic acid is CCCN1CCc2nc3cccc(Br)c3c(C(=O)O)c2C1.
What is the InChIKey of 9-bromo-2-propyl-3,4-dihydro-1H-benzo[b][1,6]naphthyridine-10-carboxylic acid?
The InChIKey is ZNEMNQJGEJWOMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17BrN2O2/c1-2-7-19-8-6-12-10(9-19)14(16(20)21)15-11(17)4-3-5-13(15)18-12/h3-5H,2,6-9H2,1H3,(H,20,21).
What are the key properties of 9-bromo-2-propyl-3,4-dihydro-1H-benzo[b][1,6]naphthyridine-10-carboxylic acid?
9-bromo-2-propyl-3,4-dihydro-1H-benzo[b][1,6]naphthyridine-10-carboxylic acid has a molecular weight of 349.23 g/mol, XLogP of 3.46, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9-bromo-2-propyl-3,4-dihydro-1H-benzo[b][1,6]naphthyridine-10-carboxylic acid is sourced from PubChem (CID 16794858), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).