C19H22N4O3 — CID 167949331
2-[5-(methoxymethyl)-1-phenylpyrazole-4-carbonyl]-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-4-one (PubChem CID 167949331) has the molecular formula C19H22N4O3 and a molecular weight of 354.41 g/mol. Its IUPAC name is 2-[5-(methoxymethyl)-1-phenylpyrazole-4-carbonyl]-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-4-one.
| Compound Name | 2-[5-(methoxymethyl)-1-phenylpyrazole-4-carbonyl]-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-4-one |
|---|---|
| PubChem CID | 167949331 |
| Molecular Formula | C19H22N4O3 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | 2-[5-(methoxymethyl)-1-phenylpyrazole-4-carbonyl]-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-4-one |
| SMILES | COCc1c(C(=O)N2CC(=O)N3CCCC3C2)cnn1-c1ccccc1 |
| InChI | InChI=1S/C19H22N4O3/c1-26-13-17-16(10-20-23(17)14-6-3-2-4-7-14)19(25)21-11-15-8-5-9-22(15)18(24)12-21/h2-4,6-7,10,15H,5,8-9,11-13H2,1H3 |
| InChIKey | HVJJRLZPDDVMMQ-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 67.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |