C19H21Br2N5O — CID 167949791
(2S)-N-[(3-bromophenyl)-[1-(3-bromophenyl)tetrazol-5-yl]methyl]-1-methoxybutan-2-amine (PubChem CID 167949791) has the molecular formula C19H21Br2N5O and a molecular weight of 495.22 g/mol. Its IUPAC name is (2S)-N-[(3-bromophenyl)-[1-(3-bromophenyl)tetrazol-5-yl]methyl]-1-methoxybutan-2-amine.
| Compound Name | (2S)-N-[(3-bromophenyl)-[1-(3-bromophenyl)tetrazol-5-yl]methyl]-1-methoxybutan-2-amine |
|---|---|
| PubChem CID | 167949791 |
| Molecular Formula | C19H21Br2N5O |
| Molecular Weight | 495.22 g/mol |
| Exact Mass | 493.01 |
| IUPAC Name | (2S)-N-[(3-bromophenyl)-[1-(3-bromophenyl)tetrazol-5-yl]methyl]-1-methoxybutan-2-amine |
| SMILES | CC[C@@H](COC)NC(c1cccc(Br)c1)c1nnnn1-c1cccc(Br)c1 |
| InChI | InChI=1S/C19H21Br2N5O/c1-3-16(12-27-2)22-18(13-6-4-7-14(20)10-13)19-23-24-25-26(19)17-9-5-8-15(21)11-17/h4-11,16,18,22H,3,12H2,1-2H3/t16-,18?/m0/s1 |
| InChIKey | MMGIAHABUKCXEL-ATNAJCNCSA-N |
| XLogP | 4.29 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.22 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |