C19H23N5O2 — CID 167951502
4-[(3aS,6aS)-3a-[3-(cyclopropylmethyl)-1,2,4-oxadiazol-5-yl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]pyridine-3-carboxamide (PubChem CID 167951502) has the molecular formula C19H23N5O2 and a molecular weight of 353.43 g/mol. Its IUPAC name is 4-[(3aS,6aS)-3a-[3-(cyclopropylmethyl)-1,2,4-oxadiazol-5-yl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]pyridine-3-carboxamide.
| Compound Name | 4-[(3aS,6aS)-3a-[3-(cyclopropylmethyl)-1,2,4-oxadiazol-5-yl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 167951502 |
| Molecular Formula | C19H23N5O2 |
| Molecular Weight | 353.43 g/mol |
| Exact Mass | 353.19 |
| IUPAC Name | 4-[(3aS,6aS)-3a-[3-(cyclopropylmethyl)-1,2,4-oxadiazol-5-yl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]pyridine-3-carboxamide |
| SMILES | NC(=O)c1cnccc1N1C[C@H]2CCC[C@@]2(c2nc(CC3CC3)no2)C1 |
| InChI | InChI=1S/C19H23N5O2/c20-17(25)14-9-21-7-5-15(14)24-10-13-2-1-6-19(13,11-24)18-22-16(23-26-18)8-12-3-4-12/h5,7,9,12-13H,1-4,6,8,10-11H2,(H2,20,25)/t13-,19-/m1/s1 |
| InChIKey | SKBIFMSDYXBOJE-BFUOFWGJSA-N |
| XLogP | 2.07 |
| TPSA | 98.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.43 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |