C16H15N5O2 — CID 167951994
N-[3-(ethylcarbamoyl)phenyl]-2H-benzotriazole-5-carboxamide (PubChem CID 167951994) has the molecular formula C16H15N5O2 and a molecular weight of 309.33 g/mol. Its IUPAC name is N-[3-(ethylcarbamoyl)phenyl]-2H-benzotriazole-5-carboxamide.
| Compound Name | N-[3-(ethylcarbamoyl)phenyl]-2H-benzotriazole-5-carboxamide |
|---|---|
| PubChem CID | 167951994 |
| Molecular Formula | C16H15N5O2 |
| Molecular Weight | 309.33 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | N-[3-(ethylcarbamoyl)phenyl]-2H-benzotriazole-5-carboxamide |
| SMILES | CCNC(=O)c1cccc(NC(=O)c2ccc3n[nH]nc3c2)c1 |
| InChI | InChI=1S/C16H15N5O2/c1-2-17-15(22)10-4-3-5-12(8-10)18-16(23)11-6-7-13-14(9-11)20-21-19-13/h3-9H,2H2,1H3,(H,17,22)(H,18,23)(H,19,20,21) |
| InChIKey | GGVVQOIYJHIRSC-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.33 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |