C13H16ClN3O2 — CID 167952116
4-(3a-amino-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-2-carbonyl)-6-chloro-1H-pyridin-2-one (PubChem CID 167952116) has the molecular formula C13H16ClN3O2 and a molecular weight of 281.74 g/mol. Its IUPAC name is 4-(3a-amino-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-2-carbonyl)-6-chloro-1H-pyridin-2-one.
| Compound Name | 4-(3a-amino-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-2-carbonyl)-6-chloro-1H-pyridin-2-one |
|---|---|
| PubChem CID | 167952116 |
| Molecular Formula | C13H16ClN3O2 |
| Molecular Weight | 281.74 g/mol |
| Exact Mass | 281.09 |
| IUPAC Name | 4-(3a-amino-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-2-carbonyl)-6-chloro-1H-pyridin-2-one |
| SMILES | NC12CCCC1CN(C(=O)c1cc(Cl)[nH]c(=O)c1)C2 |
| InChI | InChI=1S/C13H16ClN3O2/c14-10-4-8(5-11(18)16-10)12(19)17-6-9-2-1-3-13(9,15)7-17/h4-5,9H,1-3,6-7,15H2,(H,16,18) |
| InChIKey | HJMOTPZVBIOGIX-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.74 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|