About 2-[(3-benzyltriazolo[4,5-d]pyrimidin-7-yl)amino]-N-methylbutanamide
2-[(3-benzyltriazolo[4,5-d]pyrimidin-7-yl)amino]-N-methylbutanamide (PubChem CID 167952127) has the molecular formula C16H19N7O
and a molecular weight of 325.38 g/mol. Its IUPAC name is 2-[(3-benzyltriazolo[4,5-d]pyrimidin-7-yl)amino]-N-methylbutanamide.
Molecular Properties
| Compound Name | 2-[(3-benzyltriazolo[4,5-d]pyrimidin-7-yl)amino]-N-methylbutanamide |
| PubChem CID | 167952127 |
| Molecular Formula | C16H19N7O |
| Molecular Weight | 325.38 g/mol |
| Exact Mass | 325.17 |
| IUPAC Name | 2-[(3-benzyltriazolo[4,5-d]pyrimidin-7-yl)amino]-N-methylbutanamide |
| SMILES | CCC(Nc1ncnc2c1nnn2Cc1ccccc1)C(=O)NC |
| InChI | InChI=1S/C16H19N7O/c1-3-12(16(24)17-2)20-14-13-15(19-10-18-14)23(22-21-13)9-11-7-5-4-6-8-11/h4-8,10,12H,3,9H2,1-2H3,(H,17,24)(H,18,19,20) |
| InChIKey | KBGVQZAAUHPQFX-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 97.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.38 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-[(3-benzyltriazolo[4,5-d]pyrimidin-7-yl)amino]-N-methylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3-benzyltriazolo[4,5-d]pyrimidin-7-yl)amino]-N-methylbutanamide?
The IUPAC name of 2-[(3-benzyltriazolo[4,5-d]pyrimidin-7-yl)amino]-N-methylbutanamide (CID 167952127) is 2-[(3-benzyltriazolo[4,5-d]pyrimidin-7-yl)amino]-N-methylbutanamide.
What is the SMILES notation for 2-[(3-benzyltriazolo[4,5-d]pyrimidin-7-yl)amino]-N-methylbutanamide?
The canonical SMILES for 2-[(3-benzyltriazolo[4,5-d]pyrimidin-7-yl)amino]-N-methylbutanamide is CCC(Nc1ncnc2c1nnn2Cc1ccccc1)C(=O)NC.
What is the InChIKey of 2-[(3-benzyltriazolo[4,5-d]pyrimidin-7-yl)amino]-N-methylbutanamide?
The InChIKey is KBGVQZAAUHPQFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19N7O/c1-3-12(16(24)17-2)20-14-13-15(19-10-18-14)23(22-21-13)9-11-7-5-4-6-8-11/h4-8,10,12H,3,9H2,1-2H3,(H,17,24)(H,18,19,20).
What are the key properties of 2-[(3-benzyltriazolo[4,5-d]pyrimidin-7-yl)amino]-N-methylbutanamide?
2-[(3-benzyltriazolo[4,5-d]pyrimidin-7-yl)amino]-N-methylbutanamide has a molecular weight of 325.38 g/mol, XLogP of 1.21, 6 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3-benzyltriazolo[4,5-d]pyrimidin-7-yl)amino]-N-methylbutanamide is sourced from PubChem (CID 167952127), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).