C13H11F6N3O — CID 167952603
5-[[5-ethoxy-3-(trifluoromethyl)pyrazol-1-yl]methyl]-2-(trifluoromethyl)pyridine (PubChem CID 167952603) has the molecular formula C13H11F6N3O and a molecular weight of 339.24 g/mol. Its IUPAC name is 5-[[5-ethoxy-3-(trifluoromethyl)pyrazol-1-yl]methyl]-2-(trifluoromethyl)pyridine.
| Compound Name | 5-[[5-ethoxy-3-(trifluoromethyl)pyrazol-1-yl]methyl]-2-(trifluoromethyl)pyridine |
|---|---|
| PubChem CID | 167952603 |
| Molecular Formula | C13H11F6N3O |
| Molecular Weight | 339.24 g/mol |
| Exact Mass | 339.08 |
| IUPAC Name | 5-[[5-ethoxy-3-(trifluoromethyl)pyrazol-1-yl]methyl]-2-(trifluoromethyl)pyridine |
| SMILES | CCOc1cc(C(F)(F)F)nn1Cc1ccc(C(F)(F)F)nc1 |
| InChI | InChI=1S/C13H11F6N3O/c1-2-23-11-5-10(13(17,18)19)21-22(11)7-8-3-4-9(20-6-8)12(14,15)16/h3-6H,2,7H2,1H3 |
| InChIKey | DDLPWZGGHTWSLD-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.24 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |