About 1-[1-(2-methoxy-2-oxoethyl)triazol-4-yl]ethyl 7-methylpyrazolo[1,5-a]pyrimidine-6-carboxylate
1-[1-(2-methoxy-2-oxoethyl)triazol-4-yl]ethyl 7-methylpyrazolo[1,5-a]pyrimidine-6-carboxylate (PubChem CID 167952889) has the molecular formula C15H16N6O4
and a molecular weight of 344.33 g/mol. Its IUPAC name is 1-[1-(2-methoxy-2-oxoethyl)triazol-4-yl]ethyl 7-methylpyrazolo[1,5-a]pyrimidine-6-carboxylate.
Molecular Properties
| Compound Name | 1-[1-(2-methoxy-2-oxoethyl)triazol-4-yl]ethyl 7-methylpyrazolo[1,5-a]pyrimidine-6-carboxylate |
| PubChem CID | 167952889 |
| Molecular Formula | C15H16N6O4 |
| Molecular Weight | 344.33 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | 1-[1-(2-methoxy-2-oxoethyl)triazol-4-yl]ethyl 7-methylpyrazolo[1,5-a]pyrimidine-6-carboxylate |
| SMILES | COC(=O)Cn1cc(C(C)OC(=O)c2cnc3ccnn3c2C)nn1 |
| InChI | InChI=1S/C15H16N6O4/c1-9-11(6-16-13-4-5-17-21(9)13)15(23)25-10(2)12-7-20(19-18-12)8-14(22)24-3/h4-7,10H,8H2,1-3H3 |
| InChIKey | NLAYXSBWXLWIOX-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 113.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.33 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
Analyze 1-[1-(2-methoxy-2-oxoethyl)triazol-4-yl]ethyl 7-methylpyrazolo[1,5-a]pyrimidine-6-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1-(2-methoxy-2-oxoethyl)triazol-4-yl]ethyl 7-methylpyrazolo[1,5-a]pyrimidine-6-carboxylate?
The IUPAC name of 1-[1-(2-methoxy-2-oxoethyl)triazol-4-yl]ethyl 7-methylpyrazolo[1,5-a]pyrimidine-6-carboxylate (CID 167952889) is 1-[1-(2-methoxy-2-oxoethyl)triazol-4-yl]ethyl 7-methylpyrazolo[1,5-a]pyrimidine-6-carboxylate.
What is the SMILES notation for 1-[1-(2-methoxy-2-oxoethyl)triazol-4-yl]ethyl 7-methylpyrazolo[1,5-a]pyrimidine-6-carboxylate?
The canonical SMILES for 1-[1-(2-methoxy-2-oxoethyl)triazol-4-yl]ethyl 7-methylpyrazolo[1,5-a]pyrimidine-6-carboxylate is COC(=O)Cn1cc(C(C)OC(=O)c2cnc3ccnn3c2C)nn1.
What is the InChIKey of 1-[1-(2-methoxy-2-oxoethyl)triazol-4-yl]ethyl 7-methylpyrazolo[1,5-a]pyrimidine-6-carboxylate?
The InChIKey is NLAYXSBWXLWIOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16N6O4/c1-9-11(6-16-13-4-5-17-21(9)13)15(23)25-10(2)12-7-20(19-18-12)8-14(22)24-3/h4-7,10H,8H2,1-3H3.
What are the key properties of 1-[1-(2-methoxy-2-oxoethyl)triazol-4-yl]ethyl 7-methylpyrazolo[1,5-a]pyrimidine-6-carboxylate?
1-[1-(2-methoxy-2-oxoethyl)triazol-4-yl]ethyl 7-methylpyrazolo[1,5-a]pyrimidine-6-carboxylate has a molecular weight of 344.33 g/mol, XLogP of 0.72, 5 rotatable bonds, 0 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1-(2-methoxy-2-oxoethyl)triazol-4-yl]ethyl 7-methylpyrazolo[1,5-a]pyrimidine-6-carboxylate is sourced from PubChem (CID 167952889), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).