C22H26N2O — CID 167953061
(4-methyl-3,3a,5,6,7,7a-hexahydro-2H-pyrrolo[3,2-b]pyridin-1-yl)-[(1R,2R)-2-naphthalen-2-ylcyclopropyl]methanone (PubChem CID 167953061) has the molecular formula C22H26N2O and a molecular weight of 334.46 g/mol. Its IUPAC name is (4-methyl-3,3a,5,6,7,7a-hexahydro-2H-pyrrolo[3,2-b]pyridin-1-yl)-[(1R,2R)-2-naphthalen-2-ylcyclopropyl]methanone.
| Compound Name | (4-methyl-3,3a,5,6,7,7a-hexahydro-2H-pyrrolo[3,2-b]pyridin-1-yl)-[(1R,2R)-2-naphthalen-2-ylcyclopropyl]methanone |
|---|---|
| PubChem CID | 167953061 |
| Molecular Formula | C22H26N2O |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.20 |
| IUPAC Name | (4-methyl-3,3a,5,6,7,7a-hexahydro-2H-pyrrolo[3,2-b]pyridin-1-yl)-[(1R,2R)-2-naphthalen-2-ylcyclopropyl]methanone |
| SMILES | CN1CCCC2C1CCN2C(=O)[C@@H]1C[C@H]1c1ccc2ccccc2c1 |
| InChI | InChI=1S/C22H26N2O/c1-23-11-4-7-21-20(23)10-12-24(21)22(25)19-14-18(19)17-9-8-15-5-2-3-6-16(15)13-17/h2-3,5-6,8-9,13,18-21H,4,7,10-12,14H2,1H3/t18-,19+,20?,21?/m0/s1 |
| InChIKey | OGWNBTPJWRVWFU-KREBGBLKSA-N |
| XLogP | 3.64 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |