C12H15N3O4S — CID 167953738
6-(1,1-dioxo-2,3,3a,4,6,7-hexahydro-[1,2]thiazolo[2,3-a]pyrazin-5-yl)pyridine-2-carboxylic acid (PubChem CID 167953738) has the molecular formula C12H15N3O4S and a molecular weight of 297.34 g/mol. Its IUPAC name is 6-(1,1-dioxo-2,3,3a,4,6,7-hexahydro-[1,2]thiazolo[2,3-a]pyrazin-5-yl)pyridine-2-carboxylic acid.
| Compound Name | 6-(1,1-dioxo-2,3,3a,4,6,7-hexahydro-[1,2]thiazolo[2,3-a]pyrazin-5-yl)pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 167953738 |
| Molecular Formula | C12H15N3O4S |
| Molecular Weight | 297.34 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | 6-(1,1-dioxo-2,3,3a,4,6,7-hexahydro-[1,2]thiazolo[2,3-a]pyrazin-5-yl)pyridine-2-carboxylic acid |
| SMILES | O=C(O)c1cccc(N2CCN3C(CCS3(=O)=O)C2)n1 |
| InChI | InChI=1S/C12H15N3O4S/c16-12(17)10-2-1-3-11(13-10)14-5-6-15-9(8-14)4-7-20(15,18)19/h1-3,9H,4-8H2,(H,16,17) |
| InChIKey | BRFCKNIMULECIK-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 90.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.34 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |