C12H15N3O4S — CID 167954452
ethyl 3-cyano-1-[(1-methylsulfonylcyclopropyl)methyl]pyrazole-4-carboxylate (PubChem CID 167954452) has the molecular formula C12H15N3O4S and a molecular weight of 297.34 g/mol. Its IUPAC name is ethyl 3-cyano-1-[(1-methylsulfonylcyclopropyl)methyl]pyrazole-4-carboxylate.
| Compound Name | ethyl 3-cyano-1-[(1-methylsulfonylcyclopropyl)methyl]pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 167954452 |
| Molecular Formula | C12H15N3O4S |
| Molecular Weight | 297.34 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | ethyl 3-cyano-1-[(1-methylsulfonylcyclopropyl)methyl]pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cn(CC2(S(C)(=O)=O)CC2)nc1C#N |
| InChI | InChI=1S/C12H15N3O4S/c1-3-19-11(16)9-7-15(14-10(9)6-13)8-12(4-5-12)20(2,17)18/h7H,3-5,8H2,1-2H3 |
| InChIKey | JZCDNMPWRZLAPK-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 102.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.34 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |