C11H17N4O2PS — CID 167955055
5-[2-(2-dimethylphosphorylethyl)-1,3-thiazol-4-yl]-N,N-dimethyl-1,2,4-oxadiazol-3-amine (PubChem CID 167955055) has the molecular formula C11H17N4O2PS and a molecular weight of 300.32 g/mol. Its IUPAC name is 5-[2-(2-dimethylphosphorylethyl)-1,3-thiazol-4-yl]-N,N-dimethyl-1,2,4-oxadiazol-3-amine.
| Compound Name | 5-[2-(2-dimethylphosphorylethyl)-1,3-thiazol-4-yl]-N,N-dimethyl-1,2,4-oxadiazol-3-amine |
|---|---|
| PubChem CID | 167955055 |
| Molecular Formula | C11H17N4O2PS |
| Molecular Weight | 300.32 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | 5-[2-(2-dimethylphosphorylethyl)-1,3-thiazol-4-yl]-N,N-dimethyl-1,2,4-oxadiazol-3-amine |
| SMILES | CN(C)c1noc(-c2csc(CCP(C)(C)=O)n2)n1 |
| InChI | InChI=1S/C11H17N4O2PS/c1-15(2)11-13-10(17-14-11)8-7-19-9(12-8)5-6-18(3,4)16/h7H,5-6H2,1-4H3 |
| InChIKey | LSJKUNLCSHWSGW-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 72.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.32 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|