C19H26F5N3O4 — CID 167955466
trans-(1R,5R)-4,4-difluoro-5-[(2-methyl-4,5,6,7-tetrahydroindazol-3-yl)methylamino]cycloheptane-1-carboxylic acid;2,2,2-trifluoroacetic acid (PubChem CID 167955466) has the molecular formula C19H26F5N3O4 and a molecular weight of 455.42 g/mol. Its IUPAC name is trans-(1R,5R)-4,4-difluoro-5-[(2-methyl-4,5,6,7-tetrahydroindazol-3-yl)methylamino]cycloheptane-1-carboxylic acid;2,2,2-trifluoroacetic acid.
| Compound Name | trans-(1R,5R)-4,4-difluoro-5-[(2-methyl-4,5,6,7-tetrahydroindazol-3-yl)methylamino]cycloheptane-1-carboxylic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 167955466 |
| Molecular Formula | C19H26F5N3O4 |
| Molecular Weight | 455.42 g/mol |
| Exact Mass | 455.18 |
| IUPAC Name | trans-(1R,5R)-4,4-difluoro-5-[(2-methyl-4,5,6,7-tetrahydroindazol-3-yl)methylamino]cycloheptane-1-carboxylic acid;2,2,2-trifluoroacetic acid |
| SMILES | Cn1nc2c(c1CN[C@@H]1CC[C@@H](C(=O)O)CCC1(F)F)CCCC2.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H25F2N3O2.C2HF3O2/c1-22-14(12-4-2-3-5-13(12)21-22)10-20-15-7-6-11(16(23)24)8-9-17(15,18)19;3-2(4,5)1(6)7/h11,15,20H,2-10H2,1H3,(H,23,24);(H,6,7)/t11-,15-;/m1./s1 |
| InChIKey | IZOBAKKULMCUAD-GPKQSYPGSA-N |
| XLogP | 3.30 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.42 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |