About N-[2-(1,1-dioxothian-4-yl)oxyethyl]pyrido[4,3-d]pyrimidin-4-amine
N-[2-(1,1-dioxothian-4-yl)oxyethyl]pyrido[4,3-d]pyrimidin-4-amine (PubChem CID 167955633) has the molecular formula C14H18N4O3S
and a molecular weight of 322.39 g/mol. Its IUPAC name is N-[2-(1,1-dioxothian-4-yl)oxyethyl]pyrido[4,3-d]pyrimidin-4-amine.
Molecular Properties
| Compound Name | N-[2-(1,1-dioxothian-4-yl)oxyethyl]pyrido[4,3-d]pyrimidin-4-amine |
| PubChem CID | 167955633 |
| Molecular Formula | C14H18N4O3S |
| Molecular Weight | 322.39 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | N-[2-(1,1-dioxothian-4-yl)oxyethyl]pyrido[4,3-d]pyrimidin-4-amine |
| SMILES | O=S1(=O)CCC(OCCNc2ncnc3ccncc23)CC1 |
| InChI | InChI=1S/C14H18N4O3S/c19-22(20)7-2-11(3-8-22)21-6-5-16-14-12-9-15-4-1-13(12)17-10-18-14/h1,4,9-11H,2-3,5-8H2,(H,16,17,18) |
| InChIKey | ZUOZSNSLPQPLBW-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 94.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.39 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[2-(1,1-dioxothian-4-yl)oxyethyl]pyrido[4,3-d]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(1,1-dioxothian-4-yl)oxyethyl]pyrido[4,3-d]pyrimidin-4-amine?
The IUPAC name of N-[2-(1,1-dioxothian-4-yl)oxyethyl]pyrido[4,3-d]pyrimidin-4-amine (CID 167955633) is N-[2-(1,1-dioxothian-4-yl)oxyethyl]pyrido[4,3-d]pyrimidin-4-amine.
What is the SMILES notation for N-[2-(1,1-dioxothian-4-yl)oxyethyl]pyrido[4,3-d]pyrimidin-4-amine?
The canonical SMILES for N-[2-(1,1-dioxothian-4-yl)oxyethyl]pyrido[4,3-d]pyrimidin-4-amine is O=S1(=O)CCC(OCCNc2ncnc3ccncc23)CC1.
What is the InChIKey of N-[2-(1,1-dioxothian-4-yl)oxyethyl]pyrido[4,3-d]pyrimidin-4-amine?
The InChIKey is ZUOZSNSLPQPLBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N4O3S/c19-22(20)7-2-11(3-8-22)21-6-5-16-14-12-9-15-4-1-13(12)17-10-18-14/h1,4,9-11H,2-3,5-8H2,(H,16,17,18).
What are the key properties of N-[2-(1,1-dioxothian-4-yl)oxyethyl]pyrido[4,3-d]pyrimidin-4-amine?
N-[2-(1,1-dioxothian-4-yl)oxyethyl]pyrido[4,3-d]pyrimidin-4-amine has a molecular weight of 322.39 g/mol, XLogP of 1.03, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(1,1-dioxothian-4-yl)oxyethyl]pyrido[4,3-d]pyrimidin-4-amine is sourced from PubChem (CID 167955633), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).