C16H14F3NO4S — CID 167955743
3-[2-[2-(trifluoromethyl)phenyl]ethylsulfamoyl]benzoic acid (PubChem CID 167955743) has the molecular formula C16H14F3NO4S and a molecular weight of 373.35 g/mol. Its IUPAC name is 3-[2-[2-(trifluoromethyl)phenyl]ethylsulfamoyl]benzoic acid.
| Compound Name | 3-[2-[2-(trifluoromethyl)phenyl]ethylsulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 167955743 |
| Molecular Formula | C16H14F3NO4S |
| Molecular Weight | 373.35 g/mol |
| Exact Mass | 373.06 |
| IUPAC Name | 3-[2-[2-(trifluoromethyl)phenyl]ethylsulfamoyl]benzoic acid |
| SMILES | O=C(O)c1cccc(S(=O)(=O)NCCc2ccccc2C(F)(F)F)c1 |
| InChI | InChI=1S/C16H14F3NO4S/c17-16(18,19)14-7-2-1-4-11(14)8-9-20-25(23,24)13-6-3-5-12(10-13)15(21)22/h1-7,10,20H,8-9H2,(H,21,22) |
| InChIKey | ROZZALHIHVAJFC-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.35 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |