C14H23N7O — CID 167956534
5-N-[[(2S,3R)-2-(1-ethylpyrazol-4-yl)oxolan-3-yl]methyl]-3-N,3-N-dimethyl-1H-1,2,4-triazole-3,5-diamine (PubChem CID 167956534) has the molecular formula C14H23N7O and a molecular weight of 305.39 g/mol. Its IUPAC name is 5-N-[[(2S,3R)-2-(1-ethylpyrazol-4-yl)oxolan-3-yl]methyl]-3-N,3-N-dimethyl-1H-1,2,4-triazole-3,5-diamine.
| Compound Name | 5-N-[[(2S,3R)-2-(1-ethylpyrazol-4-yl)oxolan-3-yl]methyl]-3-N,3-N-dimethyl-1H-1,2,4-triazole-3,5-diamine |
|---|---|
| PubChem CID | 167956534 |
| Molecular Formula | C14H23N7O |
| Molecular Weight | 305.39 g/mol |
| Exact Mass | 305.20 |
| IUPAC Name | 5-N-[[(2S,3R)-2-(1-ethylpyrazol-4-yl)oxolan-3-yl]methyl]-3-N,3-N-dimethyl-1H-1,2,4-triazole-3,5-diamine |
| SMILES | CCn1cc([C@H]2OCC[C@@H]2CNc2nc(N(C)C)n[nH]2)cn1 |
| InChI | InChI=1S/C14H23N7O/c1-4-21-9-11(8-16-21)12-10(5-6-22-12)7-15-13-17-14(19-18-13)20(2)3/h8-10,12H,4-7H2,1-3H3,(H2,15,17,18,19)/t10-,12+/m1/s1 |
| InChIKey | UUXJHJDNFDLHAP-PWSUYJOCSA-N |
| XLogP | 1.28 |
| TPSA | 83.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.39 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |