C21H24F3N3O3 — CID 167956985
ethyl (3aR,7aS)-1-[[3-[3-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]methyl]-3,4,5,6,7,7a-hexahydro-2H-indole-3a-carboxylate (PubChem CID 167956985) has the molecular formula C21H24F3N3O3 and a molecular weight of 423.44 g/mol. Its IUPAC name is ethyl (3aR,7aS)-1-[[3-[3-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]methyl]-3,4,5,6,7,7a-hexahydro-2H-indole-3a-carboxylate.
| Compound Name | ethyl (3aR,7aS)-1-[[3-[3-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]methyl]-3,4,5,6,7,7a-hexahydro-2H-indole-3a-carboxylate |
|---|---|
| PubChem CID | 167956985 |
| Molecular Formula | C21H24F3N3O3 |
| Molecular Weight | 423.44 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | ethyl (3aR,7aS)-1-[[3-[3-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]methyl]-3,4,5,6,7,7a-hexahydro-2H-indole-3a-carboxylate |
| SMILES | CCOC(=O)[C@@]12CCCC[C@@H]1N(Cc1nc(-c3cccc(C(F)(F)F)c3)no1)CC2 |
| InChI | InChI=1S/C21H24F3N3O3/c1-2-29-19(28)20-9-4-3-8-16(20)27(11-10-20)13-17-25-18(26-30-17)14-6-5-7-15(12-14)21(22,23)24/h5-7,12,16H,2-4,8-11,13H2,1H3/t16-,20+/m0/s1 |
| InChIKey | OCEGOELRJRTWLV-OXJNMPFZSA-N |
| XLogP | 4.45 |
| TPSA | 68.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.44 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |