C15H20F3N3S — CID 167957150
6-methyl-N-[1-[5-(trifluoromethyl)thiophen-2-yl]ethyl]-1,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyridin-3-amine (PubChem CID 167957150) has the molecular formula C15H20F3N3S and a molecular weight of 331.41 g/mol. Its IUPAC name is 6-methyl-N-[1-[5-(trifluoromethyl)thiophen-2-yl]ethyl]-1,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyridin-3-amine.
| Compound Name | 6-methyl-N-[1-[5-(trifluoromethyl)thiophen-2-yl]ethyl]-1,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyridin-3-amine |
|---|---|
| PubChem CID | 167957150 |
| Molecular Formula | C15H20F3N3S |
| Molecular Weight | 331.41 g/mol |
| Exact Mass | 331.13 |
| IUPAC Name | 6-methyl-N-[1-[5-(trifluoromethyl)thiophen-2-yl]ethyl]-1,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyridin-3-amine |
| SMILES | CC1CCC2CN=C(NC(C)c3ccc(C(F)(F)F)s3)N2C1 |
| InChI | InChI=1S/C15H20F3N3S/c1-9-3-4-11-7-19-14(21(11)8-9)20-10(2)12-5-6-13(22-12)15(16,17)18/h5-6,9-11H,3-4,7-8H2,1-2H3,(H,19,20) |
| InChIKey | SWVGXHUVFITTPR-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.41 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |