About 3-chloro-N-(4-cyano-1,5-dimethylpyrazol-3-yl)-4-(difluoromethoxy)benzenesulfonamide
3-chloro-N-(4-cyano-1,5-dimethylpyrazol-3-yl)-4-(difluoromethoxy)benzenesulfonamide (PubChem CID 167957192) has the molecular formula C13H11ClF2N4O3S
and a molecular weight of 376.77 g/mol. Its IUPAC name is 3-chloro-N-(4-cyano-1,5-dimethylpyrazol-3-yl)-4-(difluoromethoxy)benzenesulfonamide.
Molecular Properties
| Compound Name | 3-chloro-N-(4-cyano-1,5-dimethylpyrazol-3-yl)-4-(difluoromethoxy)benzenesulfonamide |
| PubChem CID | 167957192 |
| Molecular Formula | C13H11ClF2N4O3S |
| Molecular Weight | 376.77 g/mol |
| Exact Mass | 376.02 |
| IUPAC Name | 3-chloro-N-(4-cyano-1,5-dimethylpyrazol-3-yl)-4-(difluoromethoxy)benzenesulfonamide |
| SMILES | Cc1c(C#N)c(NS(=O)(=O)c2ccc(OC(F)F)c(Cl)c2)nn1C |
| InChI | InChI=1S/C13H11ClF2N4O3S/c1-7-9(6-17)12(18-20(7)2)19-24(21,22)8-3-4-11(10(14)5-8)23-13(15)16/h3-5,13H,1-2H3,(H,18,19) |
| InChIKey | RMLDQUCUMSWYIA-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 97.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.77 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-chloro-N-(4-cyano-1,5-dimethylpyrazol-3-yl)-4-(difluoromethoxy)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-N-(4-cyano-1,5-dimethylpyrazol-3-yl)-4-(difluoromethoxy)benzenesulfonamide?
The IUPAC name of 3-chloro-N-(4-cyano-1,5-dimethylpyrazol-3-yl)-4-(difluoromethoxy)benzenesulfonamide (CID 167957192) is 3-chloro-N-(4-cyano-1,5-dimethylpyrazol-3-yl)-4-(difluoromethoxy)benzenesulfonamide.
What is the SMILES notation for 3-chloro-N-(4-cyano-1,5-dimethylpyrazol-3-yl)-4-(difluoromethoxy)benzenesulfonamide?
The canonical SMILES for 3-chloro-N-(4-cyano-1,5-dimethylpyrazol-3-yl)-4-(difluoromethoxy)benzenesulfonamide is Cc1c(C#N)c(NS(=O)(=O)c2ccc(OC(F)F)c(Cl)c2)nn1C.
What is the InChIKey of 3-chloro-N-(4-cyano-1,5-dimethylpyrazol-3-yl)-4-(difluoromethoxy)benzenesulfonamide?
The InChIKey is RMLDQUCUMSWYIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11ClF2N4O3S/c1-7-9(6-17)12(18-20(7)2)19-24(21,22)8-3-4-11(10(14)5-8)23-13(15)16/h3-5,13H,1-2H3,(H,18,19).
What are the key properties of 3-chloro-N-(4-cyano-1,5-dimethylpyrazol-3-yl)-4-(difluoromethoxy)benzenesulfonamide?
3-chloro-N-(4-cyano-1,5-dimethylpyrazol-3-yl)-4-(difluoromethoxy)benzenesulfonamide has a molecular weight of 376.77 g/mol, XLogP of 2.66, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-N-(4-cyano-1,5-dimethylpyrazol-3-yl)-4-(difluoromethoxy)benzenesulfonamide is sourced from PubChem (CID 167957192), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).