C26H27F5N8O3 — CID 167958445
4-N-[(3-amino-2-methylphenyl)methyl]-6,8-difluoro-2-N-[[1-(oxolan-3-ylmethyl)triazol-4-yl]methyl]quinazoline-2,4-diamine;2,2,2-trifluoroacetic acid (PubChem CID 167958445) has the molecular formula C26H27F5N8O3 and a molecular weight of 594.55 g/mol. Its IUPAC name is 4-N-[(3-amino-2-methylphenyl)methyl]-6,8-difluoro-2-N-[[1-(oxolan-3-ylmethyl)triazol-4-yl]methyl]quinazoline-2,4-diamine;2,2,2-trifluoroacetic acid.
| Compound Name | 4-N-[(3-amino-2-methylphenyl)methyl]-6,8-difluoro-2-N-[[1-(oxolan-3-ylmethyl)triazol-4-yl]methyl]quinazoline-2,4-diamine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 167958445 |
| Molecular Formula | C26H27F5N8O3 |
| Molecular Weight | 594.55 g/mol |
| Exact Mass | 594.21 |
| IUPAC Name | 4-N-[(3-amino-2-methylphenyl)methyl]-6,8-difluoro-2-N-[[1-(oxolan-3-ylmethyl)triazol-4-yl]methyl]quinazoline-2,4-diamine;2,2,2-trifluoroacetic acid |
| SMILES | Cc1c(N)cccc1CNc1nc(NCc2cn(CC3CCOC3)nn2)nc2c(F)cc(F)cc12.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C24H26F2N8O.C2HF3O2/c1-14-16(3-2-4-21(14)27)9-28-23-19-7-17(25)8-20(26)22(19)30-24(31-23)29-10-18-12-34(33-32-18)11-15-5-6-35-13-15;3-2(4,5)1(6)7/h2-4,7-8,12,15H,5-6,9-11,13,27H2,1H3,(H2,28,29,30,31);(H,6,7) |
| InChIKey | JLQKJORLXHKCOB-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 153.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.55 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|