About 5-[1-[(5-propan-2-yl-1,3,4-thiadiazol-2-yl)methyl]triazol-4-yl]pyridine-3-carboxamide
5-[1-[(5-propan-2-yl-1,3,4-thiadiazol-2-yl)methyl]triazol-4-yl]pyridine-3-carboxamide (PubChem CID 167961251) has the molecular formula C14H15N7OS
and a molecular weight of 329.39 g/mol. Its IUPAC name is 5-[1-[(5-propan-2-yl-1,3,4-thiadiazol-2-yl)methyl]triazol-4-yl]pyridine-3-carboxamide.
Molecular Properties
| Compound Name | 5-[1-[(5-propan-2-yl-1,3,4-thiadiazol-2-yl)methyl]triazol-4-yl]pyridine-3-carboxamide |
| PubChem CID | 167961251 |
| Molecular Formula | C14H15N7OS |
| Molecular Weight | 329.39 g/mol |
| Exact Mass | 329.11 |
| IUPAC Name | 5-[1-[(5-propan-2-yl-1,3,4-thiadiazol-2-yl)methyl]triazol-4-yl]pyridine-3-carboxamide |
| SMILES | CC(C)c1nnc(Cn2cc(-c3cncc(C(N)=O)c3)nn2)s1 |
| InChI | InChI=1S/C14H15N7OS/c1-8(2)14-19-18-12(23-14)7-21-6-11(17-20-21)9-3-10(13(15)22)5-16-4-9/h3-6,8H,7H2,1-2H3,(H2,15,22) |
| InChIKey | AAKDKRZCIFQRKS-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 112.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.39 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 5-[1-[(5-propan-2-yl-1,3,4-thiadiazol-2-yl)methyl]triazol-4-yl]pyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[1-[(5-propan-2-yl-1,3,4-thiadiazol-2-yl)methyl]triazol-4-yl]pyridine-3-carboxamide?
The IUPAC name of 5-[1-[(5-propan-2-yl-1,3,4-thiadiazol-2-yl)methyl]triazol-4-yl]pyridine-3-carboxamide (CID 167961251) is 5-[1-[(5-propan-2-yl-1,3,4-thiadiazol-2-yl)methyl]triazol-4-yl]pyridine-3-carboxamide.
What is the SMILES notation for 5-[1-[(5-propan-2-yl-1,3,4-thiadiazol-2-yl)methyl]triazol-4-yl]pyridine-3-carboxamide?
The canonical SMILES for 5-[1-[(5-propan-2-yl-1,3,4-thiadiazol-2-yl)methyl]triazol-4-yl]pyridine-3-carboxamide is CC(C)c1nnc(Cn2cc(-c3cncc(C(N)=O)c3)nn2)s1.
What is the InChIKey of 5-[1-[(5-propan-2-yl-1,3,4-thiadiazol-2-yl)methyl]triazol-4-yl]pyridine-3-carboxamide?
The InChIKey is AAKDKRZCIFQRKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15N7OS/c1-8(2)14-19-18-12(23-14)7-21-6-11(17-20-21)9-3-10(13(15)22)5-16-4-9/h3-6,8H,7H2,1-2H3,(H2,15,22).
What are the key properties of 5-[1-[(5-propan-2-yl-1,3,4-thiadiazol-2-yl)methyl]triazol-4-yl]pyridine-3-carboxamide?
5-[1-[(5-propan-2-yl-1,3,4-thiadiazol-2-yl)methyl]triazol-4-yl]pyridine-3-carboxamide has a molecular weight of 329.39 g/mol, XLogP of 1.46, 5 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[1-[(5-propan-2-yl-1,3,4-thiadiazol-2-yl)methyl]triazol-4-yl]pyridine-3-carboxamide is sourced from PubChem (CID 167961251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).