C38H34F2N6O3S — CID 167962676
N-[[6-fluoro-2-(4-fluorophenyl)imidazo[1,2-a]pyridin-3-yl]methyl]-3-(3-phenoxyphenyl)-N'-[(4-sulfamoylphenyl)methyl]pyrrolidine-1-carboximidamide (PubChem CID 167962676) has the molecular formula C38H34F2N6O3S and a molecular weight of 692.79 g/mol. Its IUPAC name is N-[[6-fluoro-2-(4-fluorophenyl)imidazo[1,2-a]pyridin-3-yl]methyl]-3-(3-phenoxyphenyl)-N'-[(4-sulfamoylphenyl)methyl]pyrrolidine-1-carboximidamide.
| Compound Name | N-[[6-fluoro-2-(4-fluorophenyl)imidazo[1,2-a]pyridin-3-yl]methyl]-3-(3-phenoxyphenyl)-N'-[(4-sulfamoylphenyl)methyl]pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 167962676 |
| Molecular Formula | C38H34F2N6O3S |
| Molecular Weight | 692.79 g/mol |
| Exact Mass | 692.24 |
| IUPAC Name | N-[[6-fluoro-2-(4-fluorophenyl)imidazo[1,2-a]pyridin-3-yl]methyl]-3-(3-phenoxyphenyl)-N'-[(4-sulfamoylphenyl)methyl]pyrrolidine-1-carboximidamide |
| SMILES | NS(=O)(=O)c1ccc(C/N=C(/NCc2c(-c3ccc(F)cc3)nc3ccc(F)cn23)N2CCC(c3cccc(Oc4ccccc4)c3)C2)cc1 |
| InChI | InChI=1S/C38H34F2N6O3S/c39-30-13-11-27(12-14-30)37-35(46-25-31(40)15-18-36(46)44-37)23-43-38(42-22-26-9-16-34(17-10-26)50(41,47)48)45-20-19-29(24-45)28-5-4-8-33(21-28)49-32-6-2-1-3-7-32/h1-18,21,25,29H,19-20,22-24H2,(H,42,43)(H2,41,47,48) |
| InChIKey | QNOAJCKKVRTOCA-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 114.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.79 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|